[1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid

C14H21BFNO2Si — CID 69059067

IUPAC[1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid
SMILESCC(C)(C)[Si](C)(C)n1cc(B(O)O)c2cccc(F)c21
InChIInChI=1S/C14H21BFNO2Si/c1-14(2,3)20(4,5)17-9-11(15(18)19)10-7-6-8-12(16)13(10)17/h6-9,18-19H,1-5H3
InChIKeyMNNBKTIVWLHMAD-UHFFFAOYSA-N
MW293.22 g/mol
LogP2.31
Rot. Bonds2

About [1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid

[1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid (PubChem CID 69059067) has the molecular formula C14H21BFNO2Si and a molecular weight of 293.22 g/mol. Its IUPAC name is [1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid.

Molecular Properties

Compound Name[1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid
PubChem CID69059067
Molecular FormulaC14H21BFNO2Si
Molecular Weight293.22 g/mol
Exact Mass293.14
IUPAC Name[1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid
SMILESCC(C)(C)[Si](C)(C)n1cc(B(O)O)c2cccc(F)c21
InChIInChI=1S/C14H21BFNO2Si/c1-14(2,3)20(4,5)17-9-11(15(18)19)10-7-6-8-12(16)13(10)17/h6-9,18-19H,1-5H3
InChIKeyMNNBKTIVWLHMAD-UHFFFAOYSA-N
XLogP2.31
TPSA45.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.22
LogP ≤ 52.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid?
The IUPAC name of [1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid (CID 69059067) is [1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid.
What is the SMILES notation for [1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid?
The canonical SMILES for [1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid is CC(C)(C)[Si](C)(C)n1cc(B(O)O)c2cccc(F)c21.
What is the InChIKey of [1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid?
The InChIKey is MNNBKTIVWLHMAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21BFNO2Si/c1-14(2,3)20(4,5)17-9-11(15(18)19)10-7-6-8-12(16)13(10)17/h6-9,18-19H,1-5H3.
What are the key properties of [1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid?
[1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid has a molecular weight of 293.22 g/mol, XLogP of 2.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[tert-butyl(dimethyl)silyl]-7-fluoroindol-3-yl]boronic acid is sourced from PubChem (CID 69059067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).