C17H22Cl2F3N3O6 — CID 69059596
1-[(2,4-dichlorophenyl)methyl]-2-[(3S)-pyrrolidin-3-yl]-1-(2,2,2-trifluoroethyl)hydrazine;2,3-dihydroxybutanedioic acid (PubChem CID 69059596) has the molecular formula C17H22Cl2F3N3O6 and a molecular weight of 492.28 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-2-[(3S)-pyrrolidin-3-yl]-1-(2,2,2-trifluoroethyl)hydrazine;2,3-dihydroxybutanedioic acid.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-2-[(3S)-pyrrolidin-3-yl]-1-(2,2,2-trifluoroethyl)hydrazine;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 69059596 |
| Molecular Formula | C17H22Cl2F3N3O6 |
| Molecular Weight | 492.28 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-2-[(3S)-pyrrolidin-3-yl]-1-(2,2,2-trifluoroethyl)hydrazine;2,3-dihydroxybutanedioic acid |
| SMILES | FC(F)(F)CN(Cc1ccc(Cl)cc1Cl)N[C@H]1CCNC1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C13H16Cl2F3N3.C4H6O6/c14-10-2-1-9(12(15)5-10)7-21(8-13(16,17)18)20-11-3-4-19-6-11;5-1(3(7)8)2(6)4(9)10/h1-2,5,11,19-20H,3-4,6-8H2;1-2,5-6H,(H,7,8)(H,9,10)/t11-;/m0./s1 |
| InChIKey | QCSMJPGYQKIZDY-MERQFXBCSA-N |
| XLogP | 1.10 |
| TPSA | 142.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|