About 5,6-dihydro-1H-pyrimidine-2,2-diamine;hydrochloride
5,6-dihydro-1H-pyrimidine-2,2-diamine;hydrochloride (PubChem CID 69059937) has the molecular formula C4H11ClN4
and a molecular weight of 150.61 g/mol. Its IUPAC name is 5,6-dihydro-1H-pyrimidine-2,2-diamine;hydrochloride.
Molecular Properties
| Compound Name | 5,6-dihydro-1H-pyrimidine-2,2-diamine;hydrochloride |
| PubChem CID | 69059937 |
| Molecular Formula | C4H11ClN4 |
| Molecular Weight | 150.61 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 5,6-dihydro-1H-pyrimidine-2,2-diamine;hydrochloride |
| SMILES | Cl.NC1(N)N=CCCN1 |
| InChI | InChI=1S/C4H10N4.ClH/c5-4(6)7-2-1-3-8-4;/h2,8H,1,3,5-6H2;1H |
| InChIKey | WEJNVNOTAORBIS-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.61 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dihydro-1H-pyrimidine-2,2-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-1H-pyrimidine-2,2-diamine;hydrochloride?
The IUPAC name of 5,6-dihydro-1H-pyrimidine-2,2-diamine;hydrochloride (CID 69059937) is 5,6-dihydro-1H-pyrimidine-2,2-diamine;hydrochloride.
What is the SMILES notation for 5,6-dihydro-1H-pyrimidine-2,2-diamine;hydrochloride?
The canonical SMILES for 5,6-dihydro-1H-pyrimidine-2,2-diamine;hydrochloride is Cl.NC1(N)N=CCCN1.
What is the InChIKey of 5,6-dihydro-1H-pyrimidine-2,2-diamine;hydrochloride?
The InChIKey is WEJNVNOTAORBIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N4.ClH/c5-4(6)7-2-1-3-8-4;/h2,8H,1,3,5-6H2;1H.
What are the key properties of 5,6-dihydro-1H-pyrimidine-2,2-diamine;hydrochloride?
5,6-dihydro-1H-pyrimidine-2,2-diamine;hydrochloride has a molecular weight of 150.61 g/mol, XLogP of -1.00, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-1H-pyrimidine-2,2-diamine;hydrochloride is sourced from PubChem (CID 69059937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).