C18H19N3O3 — CID 69059950
3-[3-cyano-4,6-dimethyl-1-(oxolan-2-ylmethyl)pyrrolo[2,3-b]pyridin-2-yl]prop-2-enoic acid (PubChem CID 69059950) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-[3-cyano-4,6-dimethyl-1-(oxolan-2-ylmethyl)pyrrolo[2,3-b]pyridin-2-yl]prop-2-enoic acid.
| Compound Name | 3-[3-cyano-4,6-dimethyl-1-(oxolan-2-ylmethyl)pyrrolo[2,3-b]pyridin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69059950 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 3-[3-cyano-4,6-dimethyl-1-(oxolan-2-ylmethyl)pyrrolo[2,3-b]pyridin-2-yl]prop-2-enoic acid |
| SMILES | Cc1cc(C)c2c(C#N)c(C=CC(=O)O)n(CC3CCCO3)c2n1 |
| InChI | InChI=1S/C18H19N3O3/c1-11-8-12(2)20-18-17(11)14(9-19)15(5-6-16(22)23)21(18)10-13-4-3-7-24-13/h5-6,8,13H,3-4,7,10H2,1-2H3,(H,22,23) |
| InChIKey | HWXAIHNRXGKPAS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|