C21H34N2O8 — CID 69060016
methyl 4-[[(2R)-2-[(4R,5R,6R)-6-(3,3-dimethylbut-1-enyl)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxyacetyl]amino]-5-oxopyrrolidine-2-carboxylate (PubChem CID 69060016) has the molecular formula C21H34N2O8 and a molecular weight of 442.51 g/mol. Its IUPAC name is methyl 4-[[(2R)-2-[(4R,5R,6R)-6-(3,3-dimethylbut-1-enyl)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxyacetyl]amino]-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl 4-[[(2R)-2-[(4R,5R,6R)-6-(3,3-dimethylbut-1-enyl)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxyacetyl]amino]-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 69060016 |
| Molecular Formula | C21H34N2O8 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | methyl 4-[[(2R)-2-[(4R,5R,6R)-6-(3,3-dimethylbut-1-enyl)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxyacetyl]amino]-5-oxopyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(NC(=O)[C@H](OC)[C@@H]2OC(C)(C)O[C@H](C=CC(C)(C)C)[C@H]2O)C(=O)N1 |
| InChI | InChI=1S/C21H34N2O8/c1-20(2,3)9-8-13-14(24)15(31-21(4,5)30-13)16(28-6)18(26)22-11-10-12(19(27)29-7)23-17(11)25/h8-9,11-16,24H,10H2,1-7H3,(H,22,26)(H,23,25)/t11?,12?,13-,14-,15-,16-/m1/s1 |
| InChIKey | PEDSQQDMWUTSOD-XJIVYGFWSA-N |
| XLogP | 0.03 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|