C11H13NS — CID 69060059
3a,4,5a,9a-tetrahydro-1H-pyrrolo[2,1-c][1,4]benzothiazine (PubChem CID 69060059) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is 3a,4,5a,9a-tetrahydro-1H-pyrrolo[2,1-c][1,4]benzothiazine.
| Compound Name | 3a,4,5a,9a-tetrahydro-1H-pyrrolo[2,1-c][1,4]benzothiazine |
|---|---|
| PubChem CID | 69060059 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 3a,4,5a,9a-tetrahydro-1H-pyrrolo[2,1-c][1,4]benzothiazine |
| SMILES | C1=CC2SCC3C=CCN3C2C=C1 |
| InChI | InChI=1S/C11H13NS/c1-2-6-11-10(5-1)12-7-3-4-9(12)8-13-11/h1-6,9-11H,7-8H2 |
| InChIKey | DWQOJNYSIDVWCK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|