C30H34N4O2 — CID 69060609
(E)-3-[3-cyano-4,6-dimethyl-1-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolo[2,3-b]pyridin-2-yl]-N-[(4S)-2,2-dimethyloxan-4-yl]prop-2-enamide (PubChem CID 69060609) has the molecular formula C30H34N4O2 and a molecular weight of 482.63 g/mol. Its IUPAC name is (E)-3-[3-cyano-4,6-dimethyl-1-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolo[2,3-b]pyridin-2-yl]-N-[(4S)-2,2-dimethyloxan-4-yl]prop-2-enamide.
| Compound Name | (E)-3-[3-cyano-4,6-dimethyl-1-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolo[2,3-b]pyridin-2-yl]-N-[(4S)-2,2-dimethyloxan-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 69060609 |
| Molecular Formula | C30H34N4O2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | (E)-3-[3-cyano-4,6-dimethyl-1-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]pyrrolo[2,3-b]pyridin-2-yl]-N-[(4S)-2,2-dimethyloxan-4-yl]prop-2-enamide |
| SMILES | Cc1cc(C)c2c(C#N)c(/C=C/C(=O)N[C@H]3CCOC(C)(C)C3)n([C@@H]3CCCc4ccccc43)c2n1 |
| InChI | InChI=1S/C30H34N4O2/c1-19-16-20(2)32-29-28(19)24(18-31)26(12-13-27(35)33-22-14-15-36-30(3,4)17-22)34(29)25-11-7-9-21-8-5-6-10-23(21)25/h5-6,8,10,12-13,16,22,25H,7,9,11,14-15,17H2,1-4H3,(H,33,35)/b13-12+/t22-,25+/m0/s1 |
| InChIKey | QYWZEQKSKFBZAF-LLYJWUDESA-N |
| XLogP | 5.54 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|