About 5-cyclohexyloxycarbonyl-2-methylhexa-2,5-dienoic acid;2-hydroxyethyl 2-methylprop-2-enoate
5-cyclohexyloxycarbonyl-2-methylhexa-2,5-dienoic acid;2-hydroxyethyl 2-methylprop-2-enoate (PubChem CID 69061046) has the molecular formula C20H30O7
and a molecular weight of 382.45 g/mol. Its IUPAC name is 5-cyclohexyloxycarbonyl-2-methylhexa-2,5-dienoic acid;2-hydroxyethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 5-cyclohexyloxycarbonyl-2-methylhexa-2,5-dienoic acid;2-hydroxyethyl 2-methylprop-2-enoate |
| PubChem CID | 69061046 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 5-cyclohexyloxycarbonyl-2-methylhexa-2,5-dienoic acid;2-hydroxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCO.C=C(CC=C(C)C(=O)O)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C14H20O4.C6H10O3/c1-10(13(15)16)8-9-11(2)14(17)18-12-6-4-3-5-7-12;1-5(2)6(8)9-4-3-7/h8,12H,2-7,9H2,1H3,(H,15,16);7H,1,3-4H2,2H3 |
| InChIKey | XALGLWAYNVNYGJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexyloxycarbonyl-2-methylhexa-2,5-dienoic acid;2-hydroxyethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexyloxycarbonyl-2-methylhexa-2,5-dienoic acid;2-hydroxyethyl 2-methylprop-2-enoate?
The IUPAC name of 5-cyclohexyloxycarbonyl-2-methylhexa-2,5-dienoic acid;2-hydroxyethyl 2-methylprop-2-enoate (CID 69061046) is 5-cyclohexyloxycarbonyl-2-methylhexa-2,5-dienoic acid;2-hydroxyethyl 2-methylprop-2-enoate.
What is the SMILES notation for 5-cyclohexyloxycarbonyl-2-methylhexa-2,5-dienoic acid;2-hydroxyethyl 2-methylprop-2-enoate?
The canonical SMILES for 5-cyclohexyloxycarbonyl-2-methylhexa-2,5-dienoic acid;2-hydroxyethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCO.C=C(CC=C(C)C(=O)O)C(=O)OC1CCCCC1.
What is the InChIKey of 5-cyclohexyloxycarbonyl-2-methylhexa-2,5-dienoic acid;2-hydroxyethyl 2-methylprop-2-enoate?
The InChIKey is XALGLWAYNVNYGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4.C6H10O3/c1-10(13(15)16)8-9-11(2)14(17)18-12-6-4-3-5-7-12;1-5(2)6(8)9-4-3-7/h8,12H,2-7,9H2,1H3,(H,15,16);7H,1,3-4H2,2H3.
What are the key properties of 5-cyclohexyloxycarbonyl-2-methylhexa-2,5-dienoic acid;2-hydroxyethyl 2-methylprop-2-enoate?
5-cyclohexyloxycarbonyl-2-methylhexa-2,5-dienoic acid;2-hydroxyethyl 2-methylprop-2-enoate has a molecular weight of 382.45 g/mol, XLogP of 2.94, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexyloxycarbonyl-2-methylhexa-2,5-dienoic acid;2-hydroxyethyl 2-methylprop-2-enoate is sourced from PubChem (CID 69061046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).