C17H23F3N2 — CID 69062108
(3S)-N-cyclopentyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine (PubChem CID 69062108) has the molecular formula C17H23F3N2 and a molecular weight of 312.38 g/mol. Its IUPAC name is (3S)-N-cyclopentyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine.
| Compound Name | (3S)-N-cyclopentyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 69062108 |
| Molecular Formula | C17H23F3N2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (3S)-N-cyclopentyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine |
| SMILES | FC(F)(F)c1ccc(CN(C2CCCC2)[C@H]2CCNC2)cc1 |
| InChI | InChI=1S/C17H23F3N2/c18-17(19,20)14-7-5-13(6-8-14)12-22(15-3-1-2-4-15)16-9-10-21-11-16/h5-8,15-16,21H,1-4,9-12H2/t16-/m0/s1 |
| InChIKey | HPHKLBQLOWTLMS-INIZCTEOSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |