C23H26N6O5S — CID 69063007
tert-butyl N-[2-[2-methoxy-5-[3-(2-methylfuran-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]anilino]-2-oxoethyl]carbamate (PubChem CID 69063007) has the molecular formula C23H26N6O5S and a molecular weight of 498.57 g/mol. Its IUPAC name is tert-butyl N-[2-[2-methoxy-5-[3-(2-methylfuran-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-methoxy-5-[3-(2-methylfuran-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 69063007 |
| Molecular Formula | C23H26N6O5S |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | tert-butyl N-[2-[2-methoxy-5-[3-(2-methylfuran-3-yl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]anilino]-2-oxoethyl]carbamate |
| SMILES | COc1ccc(C2=Nn3c(nnc3-c3ccoc3C)SC2)cc1NC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H26N6O5S/c1-13-15(8-9-33-13)20-26-27-21-29(20)28-17(12-35-21)14-6-7-18(32-5)16(10-14)25-19(30)11-24-22(31)34-23(2,3)4/h6-10H,11-12H2,1-5H3,(H,24,31)(H,25,30) |
| InChIKey | IERSQJWCCZHDFW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 132.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |