About 6'-prop-1-enylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane]
6'-prop-1-enylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane] (PubChem CID 69063613) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 6'-prop-1-enylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane].
Molecular Properties
| Compound Name | 6'-prop-1-enylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane] |
| PubChem CID | 69063613 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 6'-prop-1-enylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane] |
| SMILES | CC=CC1C2CCC3(OCCO3)C12 |
| InChI | InChI=1S/C11H16O2/c1-2-3-8-9-4-5-11(10(8)9)12-6-7-13-11/h2-3,8-10H,4-7H2,1H3 |
| InChIKey | WZLBZWXAUPWBKE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6'-prop-1-enylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6'-prop-1-enylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane]?
The IUPAC name of 6'-prop-1-enylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane] (CID 69063613) is 6'-prop-1-enylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane].
What is the SMILES notation for 6'-prop-1-enylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane]?
The canonical SMILES for 6'-prop-1-enylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane] is CC=CC1C2CCC3(OCCO3)C12.
What is the InChIKey of 6'-prop-1-enylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane]?
The InChIKey is WZLBZWXAUPWBKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-2-3-8-9-4-5-11(10(8)9)12-6-7-13-11/h2-3,8-10H,4-7H2,1H3.
What are the key properties of 6'-prop-1-enylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane]?
6'-prop-1-enylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane] has a molecular weight of 180.25 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6'-prop-1-enylspiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane] is sourced from PubChem (CID 69063613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).