C29H38N6O4 — CID 69063900
(2,5-dimethylphenyl)methyl-[2-[3-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamic acid (PubChem CID 69063900) has the molecular formula C29H38N6O4 and a molecular weight of 534.66 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methyl-[2-[3-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamic acid.
| Compound Name | (2,5-dimethylphenyl)methyl-[2-[3-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 69063900 |
| Molecular Formula | C29H38N6O4 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | (2,5-dimethylphenyl)methyl-[2-[3-methoxy-4-[3-(4-methylpiperazin-1-yl)propoxy]anilino]pyrimidin-4-yl]carbamic acid |
| SMILES | COc1cc(Nc2nccc(N(Cc3cc(C)ccc3C)C(=O)O)n2)ccc1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C29H38N6O4/c1-21-6-7-22(2)23(18-21)20-35(29(36)37)27-10-11-30-28(32-27)31-24-8-9-25(26(19-24)38-4)39-17-5-12-34-15-13-33(3)14-16-34/h6-11,18-19H,5,12-17,20H2,1-4H3,(H,36,37)(H,30,31,32) |
| InChIKey | SPYLZSLKMHAKKQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|