About 5-[3-(1,3-oxazol-5-yl)phenyl]pyrimidine-2,4-diamine
5-[3-(1,3-oxazol-5-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 69064849) has the molecular formula C13H11N5O
and a molecular weight of 253.27 g/mol. Its IUPAC name is 5-[3-(1,3-oxazol-5-yl)phenyl]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-[3-(1,3-oxazol-5-yl)phenyl]pyrimidine-2,4-diamine |
| PubChem CID | 69064849 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 5-[3-(1,3-oxazol-5-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(-c2cccc(-c3cnco3)c2)c(N)n1 |
| InChI | InChI=1S/C13H11N5O/c14-12-10(5-17-13(15)18-12)8-2-1-3-9(4-8)11-6-16-7-19-11/h1-7H,(H4,14,15,17,18) |
| InChIKey | ANLKIUJLHITZDK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[3-(1,3-oxazol-5-yl)phenyl]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(1,3-oxazol-5-yl)phenyl]pyrimidine-2,4-diamine?
The IUPAC name of 5-[3-(1,3-oxazol-5-yl)phenyl]pyrimidine-2,4-diamine (CID 69064849) is 5-[3-(1,3-oxazol-5-yl)phenyl]pyrimidine-2,4-diamine.
What is the SMILES notation for 5-[3-(1,3-oxazol-5-yl)phenyl]pyrimidine-2,4-diamine?
The canonical SMILES for 5-[3-(1,3-oxazol-5-yl)phenyl]pyrimidine-2,4-diamine is Nc1ncc(-c2cccc(-c3cnco3)c2)c(N)n1.
What is the InChIKey of 5-[3-(1,3-oxazol-5-yl)phenyl]pyrimidine-2,4-diamine?
The InChIKey is ANLKIUJLHITZDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N5O/c14-12-10(5-17-13(15)18-12)8-2-1-3-9(4-8)11-6-16-7-19-11/h1-7H,(H4,14,15,17,18).
What are the key properties of 5-[3-(1,3-oxazol-5-yl)phenyl]pyrimidine-2,4-diamine?
5-[3-(1,3-oxazol-5-yl)phenyl]pyrimidine-2,4-diamine has a molecular weight of 253.27 g/mol, XLogP of 1.96, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(1,3-oxazol-5-yl)phenyl]pyrimidine-2,4-diamine is sourced from PubChem (CID 69064849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).