About 1-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N'-ethylpropane-1,3-diamine;dihydrochloride
1-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N'-ethylpropane-1,3-diamine;dihydrochloride (PubChem CID 69064950) has the molecular formula C21H24Cl2N4O
and a molecular weight of 419.36 g/mol. Its IUPAC name is 1-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N'-ethylpropane-1,3-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 1-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N'-ethylpropane-1,3-diamine;dihydrochloride |
| PubChem CID | 69064950 |
| Molecular Formula | C21H24Cl2N4O |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 1-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N'-ethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CCNCCC(N)c1nc(-c2cc3ccccc3o2)nc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C21H22N4O.2ClH/c1-2-23-12-11-16(22)20-15-8-4-5-9-17(15)24-21(25-20)19-13-14-7-3-6-10-18(14)26-19;;/h3-10,13,16,23H,2,11-12,22H2,1H3;2*1H |
| InChIKey | OXPANJUDUXZFDO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N'-ethylpropane-1,3-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N'-ethylpropane-1,3-diamine;dihydrochloride?
The IUPAC name of 1-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N'-ethylpropane-1,3-diamine;dihydrochloride (CID 69064950) is 1-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N'-ethylpropane-1,3-diamine;dihydrochloride.
What is the SMILES notation for 1-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N'-ethylpropane-1,3-diamine;dihydrochloride?
The canonical SMILES for 1-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N'-ethylpropane-1,3-diamine;dihydrochloride is CCNCCC(N)c1nc(-c2cc3ccccc3o2)nc2ccccc12.Cl.Cl.
What is the InChIKey of 1-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N'-ethylpropane-1,3-diamine;dihydrochloride?
The InChIKey is OXPANJUDUXZFDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O.2ClH/c1-2-23-12-11-16(22)20-15-8-4-5-9-17(15)24-21(25-20)19-13-14-7-3-6-10-18(14)26-19;;/h3-10,13,16,23H,2,11-12,22H2,1H3;2*1H.
What are the key properties of 1-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N'-ethylpropane-1,3-diamine;dihydrochloride?
1-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N'-ethylpropane-1,3-diamine;dihydrochloride has a molecular weight of 419.36 g/mol, XLogP of 4.89, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1-benzofuran-2-yl)quinazolin-4-yl]-N'-ethylpropane-1,3-diamine;dihydrochloride is sourced from PubChem (CID 69064950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).