C32H31BN4O2 — CID 69065152
4-(2-pyridin-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)-7-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline (PubChem CID 69065152) has the molecular formula C32H31BN4O2 and a molecular weight of 514.44 g/mol. Its IUPAC name is 4-(2-pyridin-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)-7-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline.
| Compound Name | 4-(2-pyridin-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)-7-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline |
|---|---|
| PubChem CID | 69065152 |
| Molecular Formula | C32H31BN4O2 |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 4-(2-pyridin-2-yl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)-7-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]quinoline |
| SMILES | CC1(C)OB(c2ccc(-c3ccc4c(-c5c(-c6ccccn6)nn6c5CCC6)ccnc4c3)cc2)OC1(C)C |
| InChI | InChI=1S/C32H31BN4O2/c1-31(2)32(3,4)39-33(38-31)23-13-10-21(11-14-23)22-12-15-24-25(16-18-35-27(24)20-22)29-28-9-7-19-37(28)36-30(29)26-8-5-6-17-34-26/h5-6,8,10-18,20H,7,9,19H2,1-4H3 |
| InChIKey | CFEXIXKGBZYKBC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|