About (2,6-dimethylphenyl) N-[2-[2-(aminomethyl)anilino]-3-phenylphenyl]-N-pyrimidin-4-ylcarbamate
(2,6-dimethylphenyl) N-[2-[2-(aminomethyl)anilino]-3-phenylphenyl]-N-pyrimidin-4-ylcarbamate (PubChem CID 69065420) has the molecular formula C32H29N5O2
and a molecular weight of 515.62 g/mol. Its IUPAC name is (2,6-dimethylphenyl) N-[2-[2-(aminomethyl)anilino]-3-phenylphenyl]-N-pyrimidin-4-ylcarbamate.
Molecular Properties
| Compound Name | (2,6-dimethylphenyl) N-[2-[2-(aminomethyl)anilino]-3-phenylphenyl]-N-pyrimidin-4-ylcarbamate |
| PubChem CID | 69065420 |
| Molecular Formula | C32H29N5O2 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (2,6-dimethylphenyl) N-[2-[2-(aminomethyl)anilino]-3-phenylphenyl]-N-pyrimidin-4-ylcarbamate |
| SMILES | Cc1cccc(C)c1OC(=O)N(c1ccncn1)c1cccc(-c2ccccc2)c1Nc1ccccc1CN |
| InChI | InChI=1S/C32H29N5O2/c1-22-10-8-11-23(2)31(22)39-32(38)37(29-18-19-34-21-35-29)28-17-9-15-26(24-12-4-3-5-13-24)30(28)36-27-16-7-6-14-25(27)20-33/h3-19,21,36H,20,33H2,1-2H3 |
| InChIKey | NMWVFWDUVTYTTH-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2,6-dimethylphenyl) N-[2-[2-(aminomethyl)anilino]-3-phenylphenyl]-N-pyrimidin-4-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethylphenyl) N-[2-[2-(aminomethyl)anilino]-3-phenylphenyl]-N-pyrimidin-4-ylcarbamate?
The IUPAC name of (2,6-dimethylphenyl) N-[2-[2-(aminomethyl)anilino]-3-phenylphenyl]-N-pyrimidin-4-ylcarbamate (CID 69065420) is (2,6-dimethylphenyl) N-[2-[2-(aminomethyl)anilino]-3-phenylphenyl]-N-pyrimidin-4-ylcarbamate.
What is the SMILES notation for (2,6-dimethylphenyl) N-[2-[2-(aminomethyl)anilino]-3-phenylphenyl]-N-pyrimidin-4-ylcarbamate?
The canonical SMILES for (2,6-dimethylphenyl) N-[2-[2-(aminomethyl)anilino]-3-phenylphenyl]-N-pyrimidin-4-ylcarbamate is Cc1cccc(C)c1OC(=O)N(c1ccncn1)c1cccc(-c2ccccc2)c1Nc1ccccc1CN.
What is the InChIKey of (2,6-dimethylphenyl) N-[2-[2-(aminomethyl)anilino]-3-phenylphenyl]-N-pyrimidin-4-ylcarbamate?
The InChIKey is NMWVFWDUVTYTTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H29N5O2/c1-22-10-8-11-23(2)31(22)39-32(38)37(29-18-19-34-21-35-29)28-17-9-15-26(24-12-4-3-5-13-24)30(28)36-27-16-7-6-14-25(27)20-33/h3-19,21,36H,20,33H2,1-2H3.
What are the key properties of (2,6-dimethylphenyl) N-[2-[2-(aminomethyl)anilino]-3-phenylphenyl]-N-pyrimidin-4-ylcarbamate?
(2,6-dimethylphenyl) N-[2-[2-(aminomethyl)anilino]-3-phenylphenyl]-N-pyrimidin-4-ylcarbamate has a molecular weight of 515.62 g/mol, XLogP of 7.30, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethylphenyl) N-[2-[2-(aminomethyl)anilino]-3-phenylphenyl]-N-pyrimidin-4-ylcarbamate is sourced from PubChem (CID 69065420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).