C13H18N4O — CID 69065838
1-ethyl-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine (PubChem CID 69065838) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-ethyl-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine.
| Compound Name | 1-ethyl-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine |
|---|---|
| PubChem CID | 69065838 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 1-ethyl-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine |
| SMILES | CCn1ncc2c(NC3CCOCC3)ccnc21 |
| InChI | InChI=1S/C13H18N4O/c1-2-17-13-11(9-15-17)12(3-6-14-13)16-10-4-7-18-8-5-10/h3,6,9-10H,2,4-5,7-8H2,1H3,(H,14,16) |
| InChIKey | GBHQZNSOSWLYDX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |