C25H18N2O — CID 6906610
(2Z)-2-[(E)-naphthalen-1-ylmethylidenehydrazinylidene]-1,2-diphenylethanone (PubChem CID 6906610) has the molecular formula C25H18N2O and a molecular weight of 362.43 g/mol. Its IUPAC name is (2Z)-2-[(E)-naphthalen-1-ylmethylidenehydrazinylidene]-1,2-diphenylethanone.
| Compound Name | (2Z)-2-[(E)-naphthalen-1-ylmethylidenehydrazinylidene]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 6906610 |
| Molecular Formula | C25H18N2O |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (2Z)-2-[(E)-naphthalen-1-ylmethylidenehydrazinylidene]-1,2-diphenylethanone |
| SMILES | O=C(/C(=N\N=C\c1cccc2ccccc12)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H18N2O/c28-25(21-13-5-2-6-14-21)24(20-11-3-1-4-12-20)27-26-18-22-16-9-15-19-10-7-8-17-23(19)22/h1-18H/b26-18+,27-24- |
| InChIKey | ZQCLREBIUQWPCP-IVBPLKSUSA-N |
| XLogP | 5.55 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|