About 7,8-difluoro-4,4-dimethyl-5H-pyrrolo[1,2-a]quinoxaline
7,8-difluoro-4,4-dimethyl-5H-pyrrolo[1,2-a]quinoxaline (PubChem CID 69067678) has the molecular formula C13H12F2N2
and a molecular weight of 234.25 g/mol. Its IUPAC name is 7,8-difluoro-4,4-dimethyl-5H-pyrrolo[1,2-a]quinoxaline.
Molecular Properties
| Compound Name | 7,8-difluoro-4,4-dimethyl-5H-pyrrolo[1,2-a]quinoxaline |
| PubChem CID | 69067678 |
| Molecular Formula | C13H12F2N2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 7,8-difluoro-4,4-dimethyl-5H-pyrrolo[1,2-a]quinoxaline |
| SMILES | CC1(C)Nc2cc(F)c(F)cc2-n2cccc21 |
| InChI | InChI=1S/C13H12F2N2/c1-13(2)12-4-3-5-17(12)11-7-9(15)8(14)6-10(11)16-13/h3-7,16H,1-2H3 |
| InChIKey | HHKMZSWTIYECDB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,8-difluoro-4,4-dimethyl-5H-pyrrolo[1,2-a]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-difluoro-4,4-dimethyl-5H-pyrrolo[1,2-a]quinoxaline?
The IUPAC name of 7,8-difluoro-4,4-dimethyl-5H-pyrrolo[1,2-a]quinoxaline (CID 69067678) is 7,8-difluoro-4,4-dimethyl-5H-pyrrolo[1,2-a]quinoxaline.
What is the SMILES notation for 7,8-difluoro-4,4-dimethyl-5H-pyrrolo[1,2-a]quinoxaline?
The canonical SMILES for 7,8-difluoro-4,4-dimethyl-5H-pyrrolo[1,2-a]quinoxaline is CC1(C)Nc2cc(F)c(F)cc2-n2cccc21.
What is the InChIKey of 7,8-difluoro-4,4-dimethyl-5H-pyrrolo[1,2-a]quinoxaline?
The InChIKey is HHKMZSWTIYECDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F2N2/c1-13(2)12-4-3-5-17(12)11-7-9(15)8(14)6-10(11)16-13/h3-7,16H,1-2H3.
What are the key properties of 7,8-difluoro-4,4-dimethyl-5H-pyrrolo[1,2-a]quinoxaline?
7,8-difluoro-4,4-dimethyl-5H-pyrrolo[1,2-a]quinoxaline has a molecular weight of 234.25 g/mol, XLogP of 3.42, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-difluoro-4,4-dimethyl-5H-pyrrolo[1,2-a]quinoxaline is sourced from PubChem (CID 69067678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).