1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid

C12H17N3O3 — CID 69067733

IUPAC1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid
SMILESCc1cc(C(=O)N2CCCC(C(=O)O)C2)nn1C
InChIInChI=1S/C12H17N3O3/c1-8-6-10(13-14(8)2)11(16)15-5-3-4-9(7-15)12(17)18/h6,9H,3-5,7H2,1-2H3,(H,17,18)
InChIKeyLMNCMYAQZGJOJG-UHFFFAOYSA-N
MW251.29 g/mol
LogP0.67
Rot. Bonds2

About 1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid

1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid (PubChem CID 69067733) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid
PubChem CID69067733
Molecular FormulaC12H17N3O3
Molecular Weight251.29 g/mol
Exact Mass251.13
IUPAC Name1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid
SMILESCc1cc(C(=O)N2CCCC(C(=O)O)C2)nn1C
InChIInChI=1S/C12H17N3O3/c1-8-6-10(13-14(8)2)11(16)15-5-3-4-9(7-15)12(17)18/h6,9H,3-5,7H2,1-2H3,(H,17,18)
InChIKeyLMNCMYAQZGJOJG-UHFFFAOYSA-N
XLogP0.67
TPSA75.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.29
LogP ≤ 50.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid?
The IUPAC name of 1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid (CID 69067733) is 1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid.
What is the SMILES notation for 1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid?
The canonical SMILES for 1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid is Cc1cc(C(=O)N2CCCC(C(=O)O)C2)nn1C.
What is the InChIKey of 1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid?
The InChIKey is LMNCMYAQZGJOJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3/c1-8-6-10(13-14(8)2)11(16)15-5-3-4-9(7-15)12(17)18/h6,9H,3-5,7H2,1-2H3,(H,17,18).
What are the key properties of 1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid?
1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid has a molecular weight of 251.29 g/mol, XLogP of 0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,5-dimethylpyrazole-3-carbonyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 69067733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).