C26H26N2O5S2 — CID 69068783
2,4-bis(2,6-dimethylphenyl)-7-hydroxynaphthalene-1,3-disulfonamide (PubChem CID 69068783) has the molecular formula C26H26N2O5S2 and a molecular weight of 510.64 g/mol. Its IUPAC name is 2,4-bis(2,6-dimethylphenyl)-7-hydroxynaphthalene-1,3-disulfonamide.
| Compound Name | 2,4-bis(2,6-dimethylphenyl)-7-hydroxynaphthalene-1,3-disulfonamide |
|---|---|
| PubChem CID | 69068783 |
| Molecular Formula | C26H26N2O5S2 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 2,4-bis(2,6-dimethylphenyl)-7-hydroxynaphthalene-1,3-disulfonamide |
| SMILES | Cc1cccc(C)c1-c1c(S(N)(=O)=O)c(-c2c(C)cccc2C)c2ccc(O)cc2c1S(N)(=O)=O |
| InChI | InChI=1S/C26H26N2O5S2/c1-14-7-5-8-15(2)21(14)23-19-12-11-18(29)13-20(19)25(34(27,30)31)24(26(23)35(28,32)33)22-16(3)9-6-10-17(22)4/h5-13,29H,1-4H3,(H2,27,30,31)(H2,28,32,33) |
| InChIKey | CWKPXGHHPVSKLG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |