C15H18FNO2 — CID 69068843
6-(4-fluorophenyl)-8-hydroxy-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one (PubChem CID 69068843) has the molecular formula C15H18FNO2 and a molecular weight of 263.31 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-8-hydroxy-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one.
| Compound Name | 6-(4-fluorophenyl)-8-hydroxy-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
|---|---|
| PubChem CID | 69068843 |
| Molecular Formula | C15H18FNO2 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 6-(4-fluorophenyl)-8-hydroxy-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
| SMILES | O=C1CCCC2CC(O)CC(c3ccc(F)cc3)N12 |
| InChI | InChI=1S/C15H18FNO2/c16-11-6-4-10(5-7-11)14-9-13(18)8-12-2-1-3-15(19)17(12)14/h4-7,12-14,18H,1-3,8-9H2 |
| InChIKey | HLITXZMYGXNAKC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |