About 1H-pyrazole;1H-pyridin-2-one;urea
1H-pyrazole;1H-pyridin-2-one;urea (PubChem CID 69069778) has the molecular formula C9H13N5O2
and a molecular weight of 223.24 g/mol. Its IUPAC name is 1H-pyrazole;1H-pyridin-2-one;urea.
Molecular Properties
| Compound Name | 1H-pyrazole;1H-pyridin-2-one;urea |
| PubChem CID | 69069778 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 1H-pyrazole;1H-pyridin-2-one;urea |
| SMILES | NC(N)=O.O=c1cccc[nH]1.c1cn[nH]c1 |
| InChI | InChI=1S/C5H5NO.C3H4N2.CH4N2O/c7-5-3-1-2-4-6-5;1-2-4-5-3-1;2-1(3)4/h1-4H,(H,6,7);1-3H,(H,4,5);(H4,2,3,4) |
| InChIKey | XAFJBENNDQQKHZ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 130.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrazole;1H-pyridin-2-one;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole;1H-pyridin-2-one;urea?
The IUPAC name of 1H-pyrazole;1H-pyridin-2-one;urea (CID 69069778) is 1H-pyrazole;1H-pyridin-2-one;urea.
What is the SMILES notation for 1H-pyrazole;1H-pyridin-2-one;urea?
The canonical SMILES for 1H-pyrazole;1H-pyridin-2-one;urea is NC(N)=O.O=c1cccc[nH]1.c1cn[nH]c1.
What is the InChIKey of 1H-pyrazole;1H-pyridin-2-one;urea?
The InChIKey is XAFJBENNDQQKHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO.C3H4N2.CH4N2O/c7-5-3-1-2-4-6-5;1-2-4-5-3-1;2-1(3)4/h1-4H,(H,6,7);1-3H,(H,4,5);(H4,2,3,4).
What are the key properties of 1H-pyrazole;1H-pyridin-2-one;urea?
1H-pyrazole;1H-pyridin-2-one;urea has a molecular weight of 223.24 g/mol, XLogP of -0.19, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole;1H-pyridin-2-one;urea is sourced from PubChem (CID 69069778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).