C15H16N4O2S — CID 69069820
1-(3-hydroxypropyl)-3-(6-thiophen-3-yl-1H-indazol-3-yl)urea (PubChem CID 69069820) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3-(6-thiophen-3-yl-1H-indazol-3-yl)urea.
| Compound Name | 1-(3-hydroxypropyl)-3-(6-thiophen-3-yl-1H-indazol-3-yl)urea |
|---|---|
| PubChem CID | 69069820 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-(3-hydroxypropyl)-3-(6-thiophen-3-yl-1H-indazol-3-yl)urea |
| SMILES | O=C(NCCCO)Nc1n[nH]c2cc(-c3ccsc3)ccc12 |
| InChI | InChI=1S/C15H16N4O2S/c20-6-1-5-16-15(21)17-14-12-3-2-10(8-13(12)18-19-14)11-4-7-22-9-11/h2-4,7-9,20H,1,5-6H2,(H3,16,17,18,19,21) |
| InChIKey | IRJKDQSDUMCKGM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|