About 2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]benzoic acid
2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]benzoic acid (PubChem CID 6906996) has the molecular formula C17H16N2O5
and a molecular weight of 328.32 g/mol. Its IUPAC name is 2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]benzoic acid |
| PubChem CID | 6906996 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]benzoic acid |
| SMILES | COc1ccc(C(=O)N/N=C/c2ccccc2C(=O)O)cc1OC |
| InChI | InChI=1S/C17H16N2O5/c1-23-14-8-7-11(9-15(14)24-2)16(20)19-18-10-12-5-3-4-6-13(12)17(21)22/h3-10H,1-2H3,(H,19,20)(H,21,22)/b18-10+ |
| InChIKey | FSQZSJGKLGBVFG-VCHYOVAHSA-N |
| XLogP | 2.17 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]benzoic acid?
The IUPAC name of 2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]benzoic acid (CID 6906996) is 2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]benzoic acid.
What is the SMILES notation for 2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]benzoic acid?
The canonical SMILES for 2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]benzoic acid is COc1ccc(C(=O)N/N=C/c2ccccc2C(=O)O)cc1OC.
What is the InChIKey of 2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]benzoic acid?
The InChIKey is FSQZSJGKLGBVFG-VCHYOVAHSA-N. The full InChI is InChI=1S/C17H16N2O5/c1-23-14-8-7-11(9-15(14)24-2)16(20)19-18-10-12-5-3-4-6-13(12)17(21)22/h3-10H,1-2H3,(H,19,20)(H,21,22)/b18-10+.
What are the key properties of 2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]benzoic acid?
2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]benzoic acid has a molecular weight of 328.32 g/mol, XLogP of 2.17, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]benzoic acid is sourced from PubChem (CID 6906996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).