About [1-[1-(2,2-dimethylpropyl)tetrazol-5-yl]-2-(7-methyl-1H-indazol-5-yl)ethyl]carbamic acid
[1-[1-(2,2-dimethylpropyl)tetrazol-5-yl]-2-(7-methyl-1H-indazol-5-yl)ethyl]carbamic acid (PubChem CID 69070221) has the molecular formula C17H23N7O2
and a molecular weight of 357.42 g/mol. Its IUPAC name is [1-[1-(2,2-dimethylpropyl)tetrazol-5-yl]-2-(7-methyl-1H-indazol-5-yl)ethyl]carbamic acid.
Molecular Properties
| Compound Name | [1-[1-(2,2-dimethylpropyl)tetrazol-5-yl]-2-(7-methyl-1H-indazol-5-yl)ethyl]carbamic acid |
| PubChem CID | 69070221 |
| Molecular Formula | C17H23N7O2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | [1-[1-(2,2-dimethylpropyl)tetrazol-5-yl]-2-(7-methyl-1H-indazol-5-yl)ethyl]carbamic acid |
| SMILES | Cc1cc(CC(NC(=O)O)c2nnnn2CC(C)(C)C)cc2cn[nH]c12 |
| InChI | InChI=1S/C17H23N7O2/c1-10-5-11(6-12-8-18-20-14(10)12)7-13(19-16(25)26)15-21-22-23-24(15)9-17(2,3)4/h5-6,8,13,19H,7,9H2,1-4H3,(H,18,20)(H,25,26) |
| InChIKey | VHFVSVOVGTXLHN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[1-(2,2-dimethylpropyl)tetrazol-5-yl]-2-(7-methyl-1H-indazol-5-yl)ethyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[1-(2,2-dimethylpropyl)tetrazol-5-yl]-2-(7-methyl-1H-indazol-5-yl)ethyl]carbamic acid?
The IUPAC name of [1-[1-(2,2-dimethylpropyl)tetrazol-5-yl]-2-(7-methyl-1H-indazol-5-yl)ethyl]carbamic acid (CID 69070221) is [1-[1-(2,2-dimethylpropyl)tetrazol-5-yl]-2-(7-methyl-1H-indazol-5-yl)ethyl]carbamic acid.
What is the SMILES notation for [1-[1-(2,2-dimethylpropyl)tetrazol-5-yl]-2-(7-methyl-1H-indazol-5-yl)ethyl]carbamic acid?
The canonical SMILES for [1-[1-(2,2-dimethylpropyl)tetrazol-5-yl]-2-(7-methyl-1H-indazol-5-yl)ethyl]carbamic acid is Cc1cc(CC(NC(=O)O)c2nnnn2CC(C)(C)C)cc2cn[nH]c12.
What is the InChIKey of [1-[1-(2,2-dimethylpropyl)tetrazol-5-yl]-2-(7-methyl-1H-indazol-5-yl)ethyl]carbamic acid?
The InChIKey is VHFVSVOVGTXLHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N7O2/c1-10-5-11(6-12-8-18-20-14(10)12)7-13(19-16(25)26)15-21-22-23-24(15)9-17(2,3)4/h5-6,8,13,19H,7,9H2,1-4H3,(H,18,20)(H,25,26).
What are the key properties of [1-[1-(2,2-dimethylpropyl)tetrazol-5-yl]-2-(7-methyl-1H-indazol-5-yl)ethyl]carbamic acid?
[1-[1-(2,2-dimethylpropyl)tetrazol-5-yl]-2-(7-methyl-1H-indazol-5-yl)ethyl]carbamic acid has a molecular weight of 357.42 g/mol, XLogP of 2.46, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[1-(2,2-dimethylpropyl)tetrazol-5-yl]-2-(7-methyl-1H-indazol-5-yl)ethyl]carbamic acid is sourced from PubChem (CID 69070221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).