About ethoxyethane;(5R)-5-(hydroxymethyl)oxolan-2-one
ethoxyethane;(5R)-5-(hydroxymethyl)oxolan-2-one (PubChem CID 69070711) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is ethoxyethane;(5R)-5-(hydroxymethyl)oxolan-2-one.
Molecular Properties
| Compound Name | ethoxyethane;(5R)-5-(hydroxymethyl)oxolan-2-one |
| PubChem CID | 69070711 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | ethoxyethane;(5R)-5-(hydroxymethyl)oxolan-2-one |
| SMILES | CCOCC.O=C1CC[C@H](CO)O1 |
| InChI | InChI=1S/C5H8O3.C4H10O/c6-3-4-1-2-5(7)8-4;1-3-5-4-2/h4,6H,1-3H2;3-4H2,1-2H3/t4-;/m1./s1 |
| InChIKey | SSWOLWGLEPDGTC-PGMHMLKASA-N |
| XLogP | 0.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethoxyethane;(5R)-5-(hydroxymethyl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;(5R)-5-(hydroxymethyl)oxolan-2-one?
The IUPAC name of ethoxyethane;(5R)-5-(hydroxymethyl)oxolan-2-one (CID 69070711) is ethoxyethane;(5R)-5-(hydroxymethyl)oxolan-2-one.
What is the SMILES notation for ethoxyethane;(5R)-5-(hydroxymethyl)oxolan-2-one?
The canonical SMILES for ethoxyethane;(5R)-5-(hydroxymethyl)oxolan-2-one is CCOCC.O=C1CC[C@H](CO)O1.
What is the InChIKey of ethoxyethane;(5R)-5-(hydroxymethyl)oxolan-2-one?
The InChIKey is SSWOLWGLEPDGTC-PGMHMLKASA-N. The full InChI is InChI=1S/C5H8O3.C4H10O/c6-3-4-1-2-5(7)8-4;1-3-5-4-2/h4,6H,1-3H2;3-4H2,1-2H3/t4-;/m1./s1.
What are the key properties of ethoxyethane;(5R)-5-(hydroxymethyl)oxolan-2-one?
ethoxyethane;(5R)-5-(hydroxymethyl)oxolan-2-one has a molecular weight of 190.24 g/mol, XLogP of 0.73, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;(5R)-5-(hydroxymethyl)oxolan-2-one is sourced from PubChem (CID 69070711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).