C24H34N2O6 — CID 69070991
(2R)-2-[(4R,5S,6R)-6-(3,3-dimethylbut-1-enyl)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxy-N-(2-oxo-1-phenylazetidin-3-yl)acetamide (PubChem CID 69070991) has the molecular formula C24H34N2O6 and a molecular weight of 446.54 g/mol. Its IUPAC name is (2R)-2-[(4R,5S,6R)-6-(3,3-dimethylbut-1-enyl)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxy-N-(2-oxo-1-phenylazetidin-3-yl)acetamide.
| Compound Name | (2R)-2-[(4R,5S,6R)-6-(3,3-dimethylbut-1-enyl)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxy-N-(2-oxo-1-phenylazetidin-3-yl)acetamide |
|---|---|
| PubChem CID | 69070991 |
| Molecular Formula | C24H34N2O6 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (2R)-2-[(4R,5S,6R)-6-(3,3-dimethylbut-1-enyl)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxy-N-(2-oxo-1-phenylazetidin-3-yl)acetamide |
| SMILES | CO[C@@H](C(=O)NC1CN(c2ccccc2)C1=O)[C@@H]1OC(C)(C)O[C@H](C=CC(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C24H34N2O6/c1-23(2,3)13-12-17-18(27)19(32-24(4,5)31-17)20(30-6)21(28)25-16-14-26(22(16)29)15-10-8-7-9-11-15/h7-13,16-20,27H,14H2,1-6H3,(H,25,28)/t16?,17-,18+,19-,20-/m1/s1 |
| InChIKey | HDIDKKYRBXBENJ-DGDSNLKDSA-N |
| XLogP | 2.02 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|