C15H18FNO — CID 69071146
(6R,9aS)-6-(3-fluorophenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one (PubChem CID 69071146) has the molecular formula C15H18FNO and a molecular weight of 247.31 g/mol. Its IUPAC name is (6R,9aS)-6-(3-fluorophenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one.
| Compound Name | (6R,9aS)-6-(3-fluorophenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
|---|---|
| PubChem CID | 69071146 |
| Molecular Formula | C15H18FNO |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (6R,9aS)-6-(3-fluorophenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
| SMILES | O=C1CCC[C@@H]2CCC[C@H](c3cccc(F)c3)N12 |
| InChI | InChI=1S/C15H18FNO/c16-12-5-1-4-11(10-12)14-8-2-6-13-7-3-9-15(18)17(13)14/h1,4-5,10,13-14H,2-3,6-9H2/t13-,14+/m0/s1 |
| InChIKey | ZDKAEUYLYCGSKT-UONOGXRCSA-N |
| XLogP | 3.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |