C34H46N2O6 — CID 69071167
(2R)-2-[(4R,5R,6R)-6-(3,3-dimethylbut-1-enyl)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxy-N-[(3S)-2-oxo-1-[(4-phenylphenyl)methyl]azepan-3-yl]acetamide (PubChem CID 69071167) has the molecular formula C34H46N2O6 and a molecular weight of 578.75 g/mol. Its IUPAC name is (2R)-2-[(4R,5R,6R)-6-(3,3-dimethylbut-1-enyl)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxy-N-[(3S)-2-oxo-1-[(4-phenylphenyl)methyl]azepan-3-yl]acetamide.
| Compound Name | (2R)-2-[(4R,5R,6R)-6-(3,3-dimethylbut-1-enyl)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxy-N-[(3S)-2-oxo-1-[(4-phenylphenyl)methyl]azepan-3-yl]acetamide |
|---|---|
| PubChem CID | 69071167 |
| Molecular Formula | C34H46N2O6 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | (2R)-2-[(4R,5R,6R)-6-(3,3-dimethylbut-1-enyl)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxy-N-[(3S)-2-oxo-1-[(4-phenylphenyl)methyl]azepan-3-yl]acetamide |
| SMILES | CO[C@@H](C(=O)N[C@H]1CCCCN(Cc2ccc(-c3ccccc3)cc2)C1=O)[C@@H]1OC(C)(C)O[C@H](C=CC(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C34H46N2O6/c1-33(2,3)20-19-27-28(37)29(42-34(4,5)41-27)30(40-6)31(38)35-26-14-10-11-21-36(32(26)39)22-23-15-17-25(18-16-23)24-12-8-7-9-13-24/h7-9,12-13,15-20,26-30,37H,10-11,14,21-22H2,1-6H3,(H,35,38)/t26-,27+,28+,29+,30+/m0/s1 |
| InChIKey | WTFLGDIXUNIXST-XOZXEBRTSA-N |
| XLogP | 4.85 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|