C26H26N2O7S2 — CID 69071225
7-hydroxy-1-N,1-N-bis(4-methoxy-2-methylphenyl)naphthalene-1,3-disulfonamide (PubChem CID 69071225) has the molecular formula C26H26N2O7S2 and a molecular weight of 542.64 g/mol. Its IUPAC name is 7-hydroxy-1-N,1-N-bis(4-methoxy-2-methylphenyl)naphthalene-1,3-disulfonamide.
| Compound Name | 7-hydroxy-1-N,1-N-bis(4-methoxy-2-methylphenyl)naphthalene-1,3-disulfonamide |
|---|---|
| PubChem CID | 69071225 |
| Molecular Formula | C26H26N2O7S2 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 7-hydroxy-1-N,1-N-bis(4-methoxy-2-methylphenyl)naphthalene-1,3-disulfonamide |
| SMILES | COc1ccc(N(c2ccc(OC)cc2C)S(=O)(=O)c2cc(S(N)(=O)=O)cc3ccc(O)cc23)c(C)c1 |
| InChI | InChI=1S/C26H26N2O7S2/c1-16-11-20(34-3)7-9-24(16)28(25-10-8-21(35-4)12-17(25)2)37(32,33)26-15-22(36(27,30)31)13-18-5-6-19(29)14-23(18)26/h5-15,29H,1-4H3,(H2,27,30,31) |
| InChIKey | JCYIJNLANNHBQH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |