About 1,11-dihydropyrano[3,4-a]carbazole
1,11-dihydropyrano[3,4-a]carbazole (PubChem CID 69071785) has the molecular formula C15H11NO
and a molecular weight of 221.26 g/mol. Its IUPAC name is 1,11-dihydropyrano[3,4-a]carbazole.
Molecular Properties
| Compound Name | 1,11-dihydropyrano[3,4-a]carbazole |
| PubChem CID | 69071785 |
| Molecular Formula | C15H11NO |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 1,11-dihydropyrano[3,4-a]carbazole |
| SMILES | C1=Cc2ccc3c([nH]c4ccccc43)c2CO1 |
| InChI | InChI=1S/C15H11NO/c1-2-4-14-11(3-1)12-6-5-10-7-8-17-9-13(10)15(12)16-14/h1-8,16H,9H2 |
| InChIKey | GNCWMHRPKZSSPW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,11-dihydropyrano[3,4-a]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,11-dihydropyrano[3,4-a]carbazole?
The IUPAC name of 1,11-dihydropyrano[3,4-a]carbazole (CID 69071785) is 1,11-dihydropyrano[3,4-a]carbazole.
What is the SMILES notation for 1,11-dihydropyrano[3,4-a]carbazole?
The canonical SMILES for 1,11-dihydropyrano[3,4-a]carbazole is C1=Cc2ccc3c([nH]c4ccccc43)c2CO1.
What is the InChIKey of 1,11-dihydropyrano[3,4-a]carbazole?
The InChIKey is GNCWMHRPKZSSPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO/c1-2-4-14-11(3-1)12-6-5-10-7-8-17-9-13(10)15(12)16-14/h1-8,16H,9H2.
What are the key properties of 1,11-dihydropyrano[3,4-a]carbazole?
1,11-dihydropyrano[3,4-a]carbazole has a molecular weight of 221.26 g/mol, XLogP of 3.82, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,11-dihydropyrano[3,4-a]carbazole is sourced from PubChem (CID 69071785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).