C20H24ClIN4OS — CID 69071994
2-(2-chloro-4-iodoanilino)-5,5-dimethyl-8-oxo-N'-propyl-6,7-dihydro-4H-thieno[2,3-c]azepine-3-carboximidamide (PubChem CID 69071994) has the molecular formula C20H24ClIN4OS and a molecular weight of 530.86 g/mol. Its IUPAC name is 2-(2-chloro-4-iodoanilino)-5,5-dimethyl-8-oxo-N'-propyl-6,7-dihydro-4H-thieno[2,3-c]azepine-3-carboximidamide.
| Compound Name | 2-(2-chloro-4-iodoanilino)-5,5-dimethyl-8-oxo-N'-propyl-6,7-dihydro-4H-thieno[2,3-c]azepine-3-carboximidamide |
|---|---|
| PubChem CID | 69071994 |
| Molecular Formula | C20H24ClIN4OS |
| Molecular Weight | 530.86 g/mol |
| Exact Mass | 530.04 |
| IUPAC Name | 2-(2-chloro-4-iodoanilino)-5,5-dimethyl-8-oxo-N'-propyl-6,7-dihydro-4H-thieno[2,3-c]azepine-3-carboximidamide |
| SMILES | CCC/N=C(\N)c1c(Nc2ccc(I)cc2Cl)sc2c1CC(C)(C)CNC2=O |
| InChI | InChI=1S/C20H24ClIN4OS/c1-4-7-24-17(23)15-12-9-20(2,3)10-25-18(27)16(12)28-19(15)26-14-6-5-11(22)8-13(14)21/h5-6,8,26H,4,7,9-10H2,1-3H3,(H2,23,24)(H,25,27) |
| InChIKey | KOLIJVJZZPVXFB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.86 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|