C21H30F3NO2Si — CID 69072025
(6R,7S,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-(3,4,5-trifluorophenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one (PubChem CID 69072025) has the molecular formula C21H30F3NO2Si and a molecular weight of 413.56 g/mol. Its IUPAC name is (6R,7S,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-(3,4,5-trifluorophenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one.
| Compound Name | (6R,7S,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-(3,4,5-trifluorophenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
|---|---|
| PubChem CID | 69072025 |
| Molecular Formula | C21H30F3NO2Si |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (6R,7S,9aR)-7-[tert-butyl(dimethyl)silyl]oxy-6-(3,4,5-trifluorophenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2CCCC(=O)N2[C@@H]1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C21H30F3NO2Si/c1-21(2,3)28(4,5)27-17-10-9-14-7-6-8-18(26)25(14)20(17)13-11-15(22)19(24)16(23)12-13/h11-12,14,17,20H,6-10H2,1-5H3/t14-,17+,20-/m1/s1 |
| InChIKey | AOUQJNFUISPISF-CFLQYTFWSA-N |
| XLogP | 5.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|