C24H22N6O2 — CID 69073118
ethyl 3-[4-[[3-(2,3-dihydro-1H-inden-5-yl)triazolo[4,5-d]pyrimidin-5-yl]amino]phenyl]prop-2-enoate (PubChem CID 69073118) has the molecular formula C24H22N6O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is ethyl 3-[4-[[3-(2,3-dihydro-1H-inden-5-yl)triazolo[4,5-d]pyrimidin-5-yl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[[3-(2,3-dihydro-1H-inden-5-yl)triazolo[4,5-d]pyrimidin-5-yl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 69073118 |
| Molecular Formula | C24H22N6O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | ethyl 3-[4-[[3-(2,3-dihydro-1H-inden-5-yl)triazolo[4,5-d]pyrimidin-5-yl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(Nc2ncc3nnn(-c4ccc5c(c4)CCC5)c3n2)cc1 |
| InChI | InChI=1S/C24H22N6O2/c1-2-32-22(31)13-8-16-6-10-19(11-7-16)26-24-25-15-21-23(27-24)30(29-28-21)20-12-9-17-4-3-5-18(17)14-20/h6-15H,2-5H2,1H3,(H,25,26,27) |
| InChIKey | XFHKKZOVAJNXIC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|