C22H14Cl4N2O5S2 — CID 69073232
2,4-bis(2,3-dichlorophenyl)-7-hydroxynaphthalene-1,3-disulfonamide (PubChem CID 69073232) has the molecular formula C22H14Cl4N2O5S2 and a molecular weight of 592.31 g/mol. Its IUPAC name is 2,4-bis(2,3-dichlorophenyl)-7-hydroxynaphthalene-1,3-disulfonamide.
| Compound Name | 2,4-bis(2,3-dichlorophenyl)-7-hydroxynaphthalene-1,3-disulfonamide |
|---|---|
| PubChem CID | 69073232 |
| Molecular Formula | C22H14Cl4N2O5S2 |
| Molecular Weight | 592.31 g/mol |
| Exact Mass | 589.91 |
| IUPAC Name | 2,4-bis(2,3-dichlorophenyl)-7-hydroxynaphthalene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1c(-c2cccc(Cl)c2Cl)c(S(N)(=O)=O)c2cc(O)ccc2c1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H14Cl4N2O5S2/c23-15-5-1-3-12(19(15)25)17-11-8-7-10(29)9-14(11)21(34(27,30)31)18(22(17)35(28,32)33)13-4-2-6-16(24)20(13)26/h1-9,29H,(H2,27,30,31)(H2,28,32,33) |
| InChIKey | XKNNNSYDTDLKKY-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.31 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |