About 4-[[2-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]-N-pyridin-2-ylbenzamide
4-[[2-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]-N-pyridin-2-ylbenzamide (PubChem CID 69073439) has the molecular formula C21H16N4O3
and a molecular weight of 372.38 g/mol. Its IUPAC name is 4-[[2-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]-N-pyridin-2-ylbenzamide.
Molecular Properties
| Compound Name | 4-[[2-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]-N-pyridin-2-ylbenzamide |
| PubChem CID | 69073439 |
| Molecular Formula | C21H16N4O3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 4-[[2-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]-N-pyridin-2-ylbenzamide |
| SMILES | O=C(Nc1ccccn1)c1ccc(COc2ccccc2-c2nnco2)cc1 |
| InChI | InChI=1S/C21H16N4O3/c26-20(24-19-7-3-4-12-22-19)16-10-8-15(9-11-16)13-27-18-6-2-1-5-17(18)21-25-23-14-28-21/h1-12,14H,13H2,(H,22,24,26) |
| InChIKey | HRIFQWCZEUDHRI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[2-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]-N-pyridin-2-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]-N-pyridin-2-ylbenzamide?
The IUPAC name of 4-[[2-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]-N-pyridin-2-ylbenzamide (CID 69073439) is 4-[[2-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]-N-pyridin-2-ylbenzamide.
What is the SMILES notation for 4-[[2-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]-N-pyridin-2-ylbenzamide?
The canonical SMILES for 4-[[2-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]-N-pyridin-2-ylbenzamide is O=C(Nc1ccccn1)c1ccc(COc2ccccc2-c2nnco2)cc1.
What is the InChIKey of 4-[[2-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]-N-pyridin-2-ylbenzamide?
The InChIKey is HRIFQWCZEUDHRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N4O3/c26-20(24-19-7-3-4-12-22-19)16-10-8-15(9-11-16)13-27-18-6-2-1-5-17(18)21-25-23-14-28-21/h1-12,14H,13H2,(H,22,24,26).
What are the key properties of 4-[[2-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]-N-pyridin-2-ylbenzamide?
4-[[2-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]-N-pyridin-2-ylbenzamide has a molecular weight of 372.38 g/mol, XLogP of 3.96, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(1,3,4-oxadiazol-2-yl)phenoxy]methyl]-N-pyridin-2-ylbenzamide is sourced from PubChem (CID 69073439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).