C16H16F2N2O3 — CID 69073889
(E)-3-[(2R,5S)-1-but-3-enoyl-5-(2,6-difluoro-3-pyridinyl)pyrrolidin-2-yl]prop-2-enoic acid (PubChem CID 69073889) has the molecular formula C16H16F2N2O3 and a molecular weight of 322.31 g/mol. Its IUPAC name is (E)-3-[(2R,5S)-1-but-3-enoyl-5-(2,6-difluoro-3-pyridinyl)pyrrolidin-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[(2R,5S)-1-but-3-enoyl-5-(2,6-difluoro-3-pyridinyl)pyrrolidin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69073889 |
| Molecular Formula | C16H16F2N2O3 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (E)-3-[(2R,5S)-1-but-3-enoyl-5-(2,6-difluoro-3-pyridinyl)pyrrolidin-2-yl]prop-2-enoic acid |
| SMILES | C=CCC(=O)N1[C@@H](/C=C/C(=O)O)CC[C@H]1c1ccc(F)nc1F |
| InChI | InChI=1S/C16H16F2N2O3/c1-2-3-14(21)20-10(5-9-15(22)23)4-7-12(20)11-6-8-13(17)19-16(11)18/h2,5-6,8-10,12H,1,3-4,7H2,(H,22,23)/b9-5+/t10-,12+/m1/s1 |
| InChIKey | DNIOTQHAWXYQBN-PBTAIMTRSA-N |
| XLogP | 2.61 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|