C23H22ClF3N4O2 — CID 69074369
2-[3-(4-chlorophenyl)-5-oxo-4-prop-2-enyl-1,2,4-triazol-1-yl]-N-[1-[3-(trifluoromethyl)phenyl]propyl]acetamide (PubChem CID 69074369) has the molecular formula C23H22ClF3N4O2 and a molecular weight of 478.90 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-5-oxo-4-prop-2-enyl-1,2,4-triazol-1-yl]-N-[1-[3-(trifluoromethyl)phenyl]propyl]acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-5-oxo-4-prop-2-enyl-1,2,4-triazol-1-yl]-N-[1-[3-(trifluoromethyl)phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 69074369 |
| Molecular Formula | C23H22ClF3N4O2 |
| Molecular Weight | 478.90 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-5-oxo-4-prop-2-enyl-1,2,4-triazol-1-yl]-N-[1-[3-(trifluoromethyl)phenyl]propyl]acetamide |
| SMILES | C=CCn1c(-c2ccc(Cl)cc2)nn(CC(=O)NC(CC)c2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C23H22ClF3N4O2/c1-3-12-30-21(15-8-10-18(24)11-9-15)29-31(22(30)33)14-20(32)28-19(4-2)16-6-5-7-17(13-16)23(25,26)27/h3,5-11,13,19H,1,4,12,14H2,2H3,(H,28,32) |
| InChIKey | SPPCWKHTKNPUCN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.90 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|