C35H38N4O8S2 — CID 69074637
[(2S)-8-methoxy-6-[2-[(4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)sulfonyl]-2-phenylhydrazinyl]-5-(phenylsulfamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamic acid (PubChem CID 69074637) has the molecular formula C35H38N4O8S2 and a molecular weight of 706.84 g/mol. Its IUPAC name is [(2S)-8-methoxy-6-[2-[(4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)sulfonyl]-2-phenylhydrazinyl]-5-(phenylsulfamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamic acid.
| Compound Name | [(2S)-8-methoxy-6-[2-[(4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)sulfonyl]-2-phenylhydrazinyl]-5-(phenylsulfamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamic acid |
|---|---|
| PubChem CID | 69074637 |
| Molecular Formula | C35H38N4O8S2 |
| Molecular Weight | 706.84 g/mol |
| Exact Mass | 706.21 |
| IUPAC Name | [(2S)-8-methoxy-6-[2-[(4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)sulfonyl]-2-phenylhydrazinyl]-5-(phenylsulfamoyl)-1,2,3,4-tetrahydronaphthalen-2-yl]carbamic acid |
| SMILES | COc1ccc(S(=O)(=O)N(Nc2cc(OC)c3c(c2S(=O)(=O)Nc2ccccc2)CC[C@H](NC(=O)O)C3)c2ccccc2)c2c1CCCC2 |
| InChI | InChI=1S/C35H38N4O8S2/c1-46-31-19-20-33(27-16-10-9-15-26(27)31)49(44,45)39(25-13-7-4-8-14-25)37-30-22-32(47-2)29-21-24(36-35(40)41)17-18-28(29)34(30)48(42,43)38-23-11-5-3-6-12-23/h3-8,11-14,19-20,22,24,36-38H,9-10,15-18,21H2,1-2H3,(H,40,41)/t24-/m0/s1 |
| InChIKey | CRVYSRXWIDOGPO-DEOSSOPVSA-N |
| XLogP | 5.73 |
| TPSA | 163.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.84 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|