C22H34FNO2Si — CID 69074875
(6S,8R,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluorophenyl)-8-methyl-2,3,6,7,9,9a-hexahydro-1H-quinolizin-4-one (PubChem CID 69074875) has the molecular formula C22H34FNO2Si and a molecular weight of 391.60 g/mol. Its IUPAC name is (6S,8R,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluorophenyl)-8-methyl-2,3,6,7,9,9a-hexahydro-1H-quinolizin-4-one.
| Compound Name | (6S,8R,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluorophenyl)-8-methyl-2,3,6,7,9,9a-hexahydro-1H-quinolizin-4-one |
|---|---|
| PubChem CID | 69074875 |
| Molecular Formula | C22H34FNO2Si |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (6S,8R,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-(4-fluorophenyl)-8-methyl-2,3,6,7,9,9a-hexahydro-1H-quinolizin-4-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@]1(C)C[C@H]2CCCC(=O)N2[C@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H34FNO2Si/c1-21(2,3)27(5,6)26-22(4)14-18-8-7-9-20(25)24(18)19(15-22)16-10-12-17(23)13-11-16/h10-13,18-19H,7-9,14-15H2,1-6H3/t18-,19+,22-/m1/s1 |
| InChIKey | YTONMJTZRUGGRK-XQBPLPMBSA-N |
| XLogP | 5.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|