C17H13F3N2O3S — CID 69074958
ethyl 5-methyl-4-oxo-2-[(2,3,5-trifluorophenyl)methyl]-3H-thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 69074958) has the molecular formula C17H13F3N2O3S and a molecular weight of 382.36 g/mol. Its IUPAC name is ethyl 5-methyl-4-oxo-2-[(2,3,5-trifluorophenyl)methyl]-3H-thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 5-methyl-4-oxo-2-[(2,3,5-trifluorophenyl)methyl]-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 69074958 |
| Molecular Formula | C17H13F3N2O3S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | ethyl 5-methyl-4-oxo-2-[(2,3,5-trifluorophenyl)methyl]-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1sc2nc(Cc3cc(F)cc(F)c3F)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C17H13F3N2O3S/c1-3-25-17(24)14-7(2)12-15(23)21-11(22-16(12)26-14)5-8-4-9(18)6-10(19)13(8)20/h4,6H,3,5H2,1-2H3,(H,21,22,23) |
| InChIKey | MXGPUKSSROZZRB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|