C24H29BN2O5 — CID 69074959
[(2R)-1-oxo-3-phenyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindol-1-yl]propan-2-yl]carbamic acid (PubChem CID 69074959) has the molecular formula C24H29BN2O5 and a molecular weight of 436.32 g/mol. Its IUPAC name is [(2R)-1-oxo-3-phenyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindol-1-yl]propan-2-yl]carbamic acid.
| Compound Name | [(2R)-1-oxo-3-phenyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindol-1-yl]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 69074959 |
| Molecular Formula | C24H29BN2O5 |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | [(2R)-1-oxo-3-phenyl-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindol-1-yl]propan-2-yl]carbamic acid |
| SMILES | CC1(C)OB(c2ccc3c(c2)CCN3C(=O)[C@@H](Cc2ccccc2)NC(=O)O)OC1(C)C |
| InChI | InChI=1S/C24H29BN2O5/c1-23(2)24(3,4)32-25(31-23)18-10-11-20-17(15-18)12-13-27(20)21(28)19(26-22(29)30)14-16-8-6-5-7-9-16/h5-11,15,19,26H,12-14H2,1-4H3,(H,29,30)/t19-/m1/s1 |
| InChIKey | UYWIQTLSMISIFI-LJQANCHMSA-N |
| XLogP | 2.75 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|