C28H30N2O4S2 — CID 69075557
2,4-bis(2,4,6-trimethylphenyl)naphthalene-1,3-disulfonamide (PubChem CID 69075557) has the molecular formula C28H30N2O4S2 and a molecular weight of 522.69 g/mol. Its IUPAC name is 2,4-bis(2,4,6-trimethylphenyl)naphthalene-1,3-disulfonamide.
| Compound Name | 2,4-bis(2,4,6-trimethylphenyl)naphthalene-1,3-disulfonamide |
|---|---|
| PubChem CID | 69075557 |
| Molecular Formula | C28H30N2O4S2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 2,4-bis(2,4,6-trimethylphenyl)naphthalene-1,3-disulfonamide |
| SMILES | Cc1cc(C)c(-c2c(S(N)(=O)=O)c(-c3c(C)cc(C)cc3C)c3ccccc3c2S(N)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C28H30N2O4S2/c1-15-11-17(3)23(18(4)12-15)25-21-9-7-8-10-22(21)27(35(29,31)32)26(28(25)36(30,33)34)24-19(5)13-16(2)14-20(24)6/h7-14H,1-6H3,(H2,29,31,32)(H2,30,33,34) |
| InChIKey | VWBVCZSVNNHXCI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |