About CID 69075658
CID 69075658 (PubChem CID 69075658) has the molecular formula C16H16BN2O4
and a molecular weight of 311.13 g/mol.
Molecular Properties
| Compound Name | CID 69075658 |
| PubChem CID | 69075658 |
| Molecular Formula | C16H16BN2O4 |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | — |
| SMILES | NC(=O)Cc1cccc(O[B]Oc2cccc(CC(N)=O)c2)c1 |
| InChI | InChI=1S/C16H16BN2O4/c18-15(20)9-11-3-1-5-13(7-11)22-17-23-14-6-2-4-12(8-14)10-16(19)21/h1-8H,9-10H2,(H2,18,20)(H2,19,21) |
| InChIKey | JUZRXULVKSCQSU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 69075658 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69075658?
The IUPAC name of CID 69075658 (CID 69075658) is not available.
What is the SMILES notation for CID 69075658?
The canonical SMILES for CID 69075658 is NC(=O)Cc1cccc(O[B]Oc2cccc(CC(N)=O)c2)c1.
What is the InChIKey of CID 69075658?
The InChIKey is JUZRXULVKSCQSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BN2O4/c18-15(20)9-11-3-1-5-13(7-11)22-17-23-14-6-2-4-12(8-14)10-16(19)21/h1-8H,9-10H2,(H2,18,20)(H2,19,21).
What are the key properties of CID 69075658?
CID 69075658 has a molecular weight of 311.13 g/mol, XLogP of 0.73, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69075658 is sourced from PubChem (CID 69075658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).