C8H15NO3 — CID 69075758
(3R)-3-(2-hydroxyethyl)piperidine-1-carboxylic acid (PubChem CID 69075758) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is (3R)-3-(2-hydroxyethyl)piperidine-1-carboxylic acid.
| Compound Name | (3R)-3-(2-hydroxyethyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69075758 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (3R)-3-(2-hydroxyethyl)piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC[C@H](CCO)C1 |
| InChI | InChI=1S/C8H15NO3/c10-5-3-7-2-1-4-9(6-7)8(11)12/h7,10H,1-6H2,(H,11,12)/t7-/m1/s1 |
| InChIKey | MOJKEAHQTJSPTH-SSDOTTSWSA-N |
| XLogP | 0.76 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |