About N,N-dimethyl-2-[2-(trifluoromethyl)purin-9-yl]pyrimidin-4-amine;N-methylmethanamine
N,N-dimethyl-2-[2-(trifluoromethyl)purin-9-yl]pyrimidin-4-amine;N-methylmethanamine (PubChem CID 69075847) has the molecular formula C14H17F3N8
and a molecular weight of 354.34 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-(trifluoromethyl)purin-9-yl]pyrimidin-4-amine;N-methylmethanamine.
Molecular Properties
| Compound Name | N,N-dimethyl-2-[2-(trifluoromethyl)purin-9-yl]pyrimidin-4-amine;N-methylmethanamine |
| PubChem CID | 69075847 |
| Molecular Formula | C14H17F3N8 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N,N-dimethyl-2-[2-(trifluoromethyl)purin-9-yl]pyrimidin-4-amine;N-methylmethanamine |
| SMILES | CN(C)c1ccnc(-n2cnc3cnc(C(F)(F)F)nc32)n1.CNC |
| InChI | InChI=1S/C12H10F3N7.C2H7N/c1-21(2)8-3-4-16-11(19-8)22-6-18-7-5-17-10(12(13,14)15)20-9(7)22;1-3-2/h3-6H,1-2H3;3H,1-2H3 |
| InChIKey | IOAXTDCSZCAXOI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N,N-dimethyl-2-[2-(trifluoromethyl)purin-9-yl]pyrimidin-4-amine;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-[2-(trifluoromethyl)purin-9-yl]pyrimidin-4-amine;N-methylmethanamine?
The IUPAC name of N,N-dimethyl-2-[2-(trifluoromethyl)purin-9-yl]pyrimidin-4-amine;N-methylmethanamine (CID 69075847) is N,N-dimethyl-2-[2-(trifluoromethyl)purin-9-yl]pyrimidin-4-amine;N-methylmethanamine.
What is the SMILES notation for N,N-dimethyl-2-[2-(trifluoromethyl)purin-9-yl]pyrimidin-4-amine;N-methylmethanamine?
The canonical SMILES for N,N-dimethyl-2-[2-(trifluoromethyl)purin-9-yl]pyrimidin-4-amine;N-methylmethanamine is CN(C)c1ccnc(-n2cnc3cnc(C(F)(F)F)nc32)n1.CNC.
What is the InChIKey of N,N-dimethyl-2-[2-(trifluoromethyl)purin-9-yl]pyrimidin-4-amine;N-methylmethanamine?
The InChIKey is IOAXTDCSZCAXOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3N7.C2H7N/c1-21(2)8-3-4-16-11(19-8)22-6-18-7-5-17-10(12(13,14)15)20-9(7)22;1-3-2/h3-6H,1-2H3;3H,1-2H3.
What are the key properties of N,N-dimethyl-2-[2-(trifluoromethyl)purin-9-yl]pyrimidin-4-amine;N-methylmethanamine?
N,N-dimethyl-2-[2-(trifluoromethyl)purin-9-yl]pyrimidin-4-amine;N-methylmethanamine has a molecular weight of 354.34 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-[2-(trifluoromethyl)purin-9-yl]pyrimidin-4-amine;N-methylmethanamine is sourced from PubChem (CID 69075847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).