C21H32FNO2Si — CID 69076181
(6S,8R,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-(3-fluorophenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one (PubChem CID 69076181) has the molecular formula C21H32FNO2Si and a molecular weight of 377.58 g/mol. Its IUPAC name is (6S,8R,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-(3-fluorophenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one.
| Compound Name | (6S,8R,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-(3-fluorophenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
|---|---|
| PubChem CID | 69076181 |
| Molecular Formula | C21H32FNO2Si |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | (6S,8R,9aR)-8-[tert-butyl(dimethyl)silyl]oxy-6-(3-fluorophenyl)-1,2,3,6,7,8,9,9a-octahydroquinolizin-4-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H]2CCCC(=O)N2[C@H](c2cccc(F)c2)C1 |
| InChI | InChI=1S/C21H32FNO2Si/c1-21(2,3)26(4,5)25-18-13-17-10-7-11-20(24)23(17)19(14-18)15-8-6-9-16(22)12-15/h6,8-9,12,17-19H,7,10-11,13-14H2,1-5H3/t17-,18-,19+/m1/s1 |
| InChIKey | GJRIPALMGLMXPD-QRVBRYPASA-N |
| XLogP | 5.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|