About 5-(3-bromo-4-methylphenyl)-6-methylpyrimidine-2,4-diamine;hydrochloride
5-(3-bromo-4-methylphenyl)-6-methylpyrimidine-2,4-diamine;hydrochloride (PubChem CID 69076409) has the molecular formula C12H14BrClN4
and a molecular weight of 329.63 g/mol. Its IUPAC name is 5-(3-bromo-4-methylphenyl)-6-methylpyrimidine-2,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | 5-(3-bromo-4-methylphenyl)-6-methylpyrimidine-2,4-diamine;hydrochloride |
| PubChem CID | 69076409 |
| Molecular Formula | C12H14BrClN4 |
| Molecular Weight | 329.63 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 5-(3-bromo-4-methylphenyl)-6-methylpyrimidine-2,4-diamine;hydrochloride |
| SMILES | Cc1ccc(-c2c(C)nc(N)nc2N)cc1Br.Cl |
| InChI | InChI=1S/C12H13BrN4.ClH/c1-6-3-4-8(5-9(6)13)10-7(2)16-12(15)17-11(10)14;/h3-5H,1-2H3,(H4,14,15,16,17);1H |
| InChIKey | NQYNVFKXPWODJQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.63 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-bromo-4-methylphenyl)-6-methylpyrimidine-2,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-bromo-4-methylphenyl)-6-methylpyrimidine-2,4-diamine;hydrochloride?
The IUPAC name of 5-(3-bromo-4-methylphenyl)-6-methylpyrimidine-2,4-diamine;hydrochloride (CID 69076409) is 5-(3-bromo-4-methylphenyl)-6-methylpyrimidine-2,4-diamine;hydrochloride.
What is the SMILES notation for 5-(3-bromo-4-methylphenyl)-6-methylpyrimidine-2,4-diamine;hydrochloride?
The canonical SMILES for 5-(3-bromo-4-methylphenyl)-6-methylpyrimidine-2,4-diamine;hydrochloride is Cc1ccc(-c2c(C)nc(N)nc2N)cc1Br.Cl.
What is the InChIKey of 5-(3-bromo-4-methylphenyl)-6-methylpyrimidine-2,4-diamine;hydrochloride?
The InChIKey is NQYNVFKXPWODJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN4.ClH/c1-6-3-4-8(5-9(6)13)10-7(2)16-12(15)17-11(10)14;/h3-5H,1-2H3,(H4,14,15,16,17);1H.
What are the key properties of 5-(3-bromo-4-methylphenyl)-6-methylpyrimidine-2,4-diamine;hydrochloride?
5-(3-bromo-4-methylphenyl)-6-methylpyrimidine-2,4-diamine;hydrochloride has a molecular weight of 329.63 g/mol, XLogP of 3.11, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-bromo-4-methylphenyl)-6-methylpyrimidine-2,4-diamine;hydrochloride is sourced from PubChem (CID 69076409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).