C22H34N6O — CID 69076509
2-tert-butyl-5-cyclopropyl-4-[4-[3-(1-methylpyrazol-3-yl)oxypropyl]piperazin-1-yl]pyrimidine (PubChem CID 69076509) has the molecular formula C22H34N6O and a molecular weight of 398.56 g/mol. Its IUPAC name is 2-tert-butyl-5-cyclopropyl-4-[4-[3-(1-methylpyrazol-3-yl)oxypropyl]piperazin-1-yl]pyrimidine.
| Compound Name | 2-tert-butyl-5-cyclopropyl-4-[4-[3-(1-methylpyrazol-3-yl)oxypropyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 69076509 |
| Molecular Formula | C22H34N6O |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | 2-tert-butyl-5-cyclopropyl-4-[4-[3-(1-methylpyrazol-3-yl)oxypropyl]piperazin-1-yl]pyrimidine |
| SMILES | Cn1ccc(OCCCN2CCN(c3nc(C(C)(C)C)ncc3C3CC3)CC2)n1 |
| InChI | InChI=1S/C22H34N6O/c1-22(2,3)21-23-16-18(17-6-7-17)20(24-21)28-13-11-27(12-14-28)9-5-15-29-19-8-10-26(4)25-19/h8,10,16-17H,5-7,9,11-15H2,1-4H3 |
| InChIKey | SQSXALHLBMYNQZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|